C18H20F3N2O+ — CID 2455180
[2-(3-methylanilino)-2-oxoethyl]-[2-[4-(trifluoromethyl)phenyl]ethyl]azanium (PubChem CID 2455180) has the molecular formula C18H20F3N2O+ and a molecular weight of 337.37 g/mol. Its IUPAC name is [2-(3-methylanilino)-2-oxoethyl]-[2-[4-(trifluoromethyl)phenyl]ethyl]azanium.
| Compound Name | [2-(3-methylanilino)-2-oxoethyl]-[2-[4-(trifluoromethyl)phenyl]ethyl]azanium |
|---|---|
| PubChem CID | 2455180 |
| Molecular Formula | C18H20F3N2O+ |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | [2-(3-methylanilino)-2-oxoethyl]-[2-[4-(trifluoromethyl)phenyl]ethyl]azanium |
| SMILES | Cc1cccc(NC(=O)C[NH2+]CCc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C18H19F3N2O/c1-13-3-2-4-16(11-13)23-17(24)12-22-10-9-14-5-7-15(8-6-14)18(19,20)21/h2-8,11,22H,9-10,12H2,1H3,(H,23,24)/p+1 |
| InChIKey | CHZUADIJBNBTBY-UHFFFAOYSA-O |
| XLogP | 2.76 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|