C15H24N3O3+ — CID 7144701
3-methoxypropyl-[2-[[2-(3-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]azanium (PubChem CID 7144701) has the molecular formula C15H24N3O3+ and a molecular weight of 294.38 g/mol. Its IUPAC name is 3-methoxypropyl-[2-[[2-(3-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]azanium.
| Compound Name | 3-methoxypropyl-[2-[[2-(3-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 7144701 |
| Molecular Formula | C15H24N3O3+ |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 3-methoxypropyl-[2-[[2-(3-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]azanium |
| SMILES | COCCC[NH2+]CC(=O)NCC(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C15H23N3O3/c1-12-5-3-6-13(9-12)18-15(20)11-17-14(19)10-16-7-4-8-21-2/h3,5-6,9,16H,4,7-8,10-11H2,1-2H3,(H,17,19)(H,18,20)/p+1 |
| InChIKey | VBOQPKMBDVTLKZ-UHFFFAOYSA-O |
| XLogP | -0.35 |
| TPSA | 84.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|