C15H25N2O4+ — CID 8894865
[2-[(3,4-dimethoxyphenyl)methylamino]-2-oxoethyl]-(3-methoxypropyl)azanium (PubChem CID 8894865) has the molecular formula C15H25N2O4+ and a molecular weight of 297.38 g/mol. Its IUPAC name is [2-[(3,4-dimethoxyphenyl)methylamino]-2-oxoethyl]-(3-methoxypropyl)azanium.
| Compound Name | [2-[(3,4-dimethoxyphenyl)methylamino]-2-oxoethyl]-(3-methoxypropyl)azanium |
|---|---|
| PubChem CID | 8894865 |
| Molecular Formula | C15H25N2O4+ |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | [2-[(3,4-dimethoxyphenyl)methylamino]-2-oxoethyl]-(3-methoxypropyl)azanium |
| SMILES | COCCC[NH2+]CC(=O)NCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H24N2O4/c1-19-8-4-7-16-11-15(18)17-10-12-5-6-13(20-2)14(9-12)21-3/h5-6,9,16H,4,7-8,10-11H2,1-3H3,(H,17,18)/p+1 |
| InChIKey | IRLCSBCVWZPPIX-UHFFFAOYSA-O |
| XLogP | -0.08 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|