C20H25N3O6 — CID 24553444
N-[(2S)-1-[2-(4-butoxy-3-methoxybenzoyl)hydrazinyl]-1-oxopropan-2-yl]furan-2-carboxamide (PubChem CID 24553444) has the molecular formula C20H25N3O6 and a molecular weight of 403.44 g/mol. Its IUPAC name is N-[(2S)-1-[2-(4-butoxy-3-methoxybenzoyl)hydrazinyl]-1-oxopropan-2-yl]furan-2-carboxamide.
| Compound Name | N-[(2S)-1-[2-(4-butoxy-3-methoxybenzoyl)hydrazinyl]-1-oxopropan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 24553444 |
| Molecular Formula | C20H25N3O6 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-[(2S)-1-[2-(4-butoxy-3-methoxybenzoyl)hydrazinyl]-1-oxopropan-2-yl]furan-2-carboxamide |
| SMILES | CCCCOc1ccc(C(=O)NNC(=O)[C@H](C)NC(=O)c2ccco2)cc1OC |
| InChI | InChI=1S/C20H25N3O6/c1-4-5-10-28-15-9-8-14(12-17(15)27-3)19(25)23-22-18(24)13(2)21-20(26)16-7-6-11-29-16/h6-9,11-13H,4-5,10H2,1-3H3,(H,21,26)(H,22,24)(H,23,25)/t13-/m0/s1 |
| InChIKey | ARWSTJKSDKSIFL-ZDUSSCGKSA-N |
| XLogP | 2.05 |
| TPSA | 118.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|