C13H10ClF3N4O2S2 — CID 24555011
2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 24555011) has the molecular formula C13H10ClF3N4O2S2 and a molecular weight of 410.83 g/mol. Its IUPAC name is 2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 24555011 |
| Molecular Formula | C13H10ClF3N4O2S2 |
| Molecular Weight | 410.83 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | 2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | C=CCSc1nnc(NC(=O)Cn2cc(C(F)(F)F)cc(Cl)c2=O)s1 |
| InChI | InChI=1S/C13H10ClF3N4O2S2/c1-2-3-24-12-20-19-11(25-12)18-9(22)6-21-5-7(13(15,16)17)4-8(14)10(21)23/h2,4-5H,1,3,6H2,(H,18,19,22) |
| InChIKey | HBRLYXHSSOTTTR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.83 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|