C18H14Cl2N2O4 — CID 24559580
N'-[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide (PubChem CID 24559580) has the molecular formula C18H14Cl2N2O4 and a molecular weight of 393.23 g/mol. Its IUPAC name is N'-[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide.
| Compound Name | N'-[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
|---|---|
| PubChem CID | 24559580 |
| Molecular Formula | C18H14Cl2N2O4 |
| Molecular Weight | 393.23 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | N'-[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
| SMILES | O=C(/C=C/c1cc(Cl)cc(Cl)c1)NNC(=O)C1COc2ccccc2O1 |
| InChI | InChI=1S/C18H14Cl2N2O4/c19-12-7-11(8-13(20)9-12)5-6-17(23)21-22-18(24)16-10-25-14-3-1-2-4-15(14)26-16/h1-9,16H,10H2,(H,21,23)(H,22,24)/b6-5+ |
| InChIKey | AZKLZZZBEIEVLI-AATRIKPKSA-N |
| XLogP | 2.99 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.23 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|