C23H27ClN4O4S — CID 24559888
1-[(2-chlorophenyl)methyl]-N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]pyrazole-4-carboxamide (PubChem CID 24559888) has the molecular formula C23H27ClN4O4S and a molecular weight of 491.01 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]pyrazole-4-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 24559888 |
| Molecular Formula | C23H27ClN4O4S |
| Molecular Weight | 491.01 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]pyrazole-4-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cnn(Cc3ccccc3Cl)c2)cc1S(=O)(=O)N(CC)CC |
| InChI | InChI=1S/C23H27ClN4O4S/c1-4-28(5-2)33(30,31)22-13-19(11-12-21(22)32-6-3)26-23(29)18-14-25-27(16-18)15-17-9-7-8-10-20(17)24/h7-14,16H,4-6,15H2,1-3H3,(H,26,29) |
| InChIKey | GQEOGIDUDSUIGX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.01 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |