C21H18ClN9O2 — CID 24562679
[4-amino-6-(4-chloroanilino)-1,3,5-triazin-2-yl]methyl (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate (PubChem CID 24562679) has the molecular formula C21H18ClN9O2 and a molecular weight of 463.89 g/mol. Its IUPAC name is [4-amino-6-(4-chloroanilino)-1,3,5-triazin-2-yl]methyl (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate.
| Compound Name | [4-amino-6-(4-chloroanilino)-1,3,5-triazin-2-yl]methyl (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 24562679 |
| Molecular Formula | C21H18ClN9O2 |
| Molecular Weight | 463.89 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | [4-amino-6-(4-chloroanilino)-1,3,5-triazin-2-yl]methyl (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate |
| SMILES | Cc1nnnn1/C(=C\c1ccccc1)C(=O)OCc1nc(N)nc(Nc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C21H18ClN9O2/c1-13-28-29-30-31(13)17(11-14-5-3-2-4-6-14)19(32)33-12-18-25-20(23)27-21(26-18)24-16-9-7-15(22)8-10-16/h2-11H,12H2,1H3,(H3,23,24,25,26,27)/b17-11- |
| InChIKey | MQODICHCBCJZQZ-BOPFTXTBSA-N |
| XLogP | 2.89 |
| TPSA | 146.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.89 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|