C19H17ClN4O3 — CID 6526656
2-(4-chlorophenoxy)ethyl (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate (PubChem CID 6526656) has the molecular formula C19H17ClN4O3 and a molecular weight of 384.82 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)ethyl (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate.
| Compound Name | 2-(4-chlorophenoxy)ethyl (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 6526656 |
| Molecular Formula | C19H17ClN4O3 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 2-(4-chlorophenoxy)ethyl (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate |
| SMILES | Cc1nnnn1/C(=C\c1ccccc1)C(=O)OCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H17ClN4O3/c1-14-21-22-23-24(14)18(13-15-5-3-2-4-6-15)19(25)27-12-11-26-17-9-7-16(20)8-10-17/h2-10,13H,11-12H2,1H3/b18-13- |
| InChIKey | DCLNFSAFNOQZBM-AQTBWJFISA-N |
| XLogP | 3.26 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|