C27H31N3O5 — CID 24566084
ethyl (E)-3-[4-[[2-[4-(4-tert-butylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]phenyl]prop-2-enoate (PubChem CID 24566084) has the molecular formula C27H31N3O5 and a molecular weight of 477.56 g/mol. Its IUPAC name is ethyl (E)-3-[4-[[2-[4-(4-tert-butylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[[2-[4-(4-tert-butylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 24566084 |
| Molecular Formula | C27H31N3O5 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | ethyl (E)-3-[4-[[2-[4-(4-tert-butylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(NC(=O)CN2C(=O)NC(C)(c3ccc(C(C)(C)C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H31N3O5/c1-6-35-23(32)16-9-18-7-14-21(15-8-18)28-22(31)17-30-24(33)27(5,29-25(30)34)20-12-10-19(11-13-20)26(2,3)4/h7-16H,6,17H2,1-5H3,(H,28,31)(H,29,34)/b16-9+ |
| InChIKey | BSKGNJBKLSHIHC-CXUHLZMHSA-N |
| XLogP | 3.97 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|