C15H13N3O2S2 — CID 24570381
N-[4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-yl]-1-oxidopyridin-1-ium-3-carboxamide (PubChem CID 24570381) has the molecular formula C15H13N3O2S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-[4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-yl]-1-oxidopyridin-1-ium-3-carboxamide.
| Compound Name | N-[4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-yl]-1-oxidopyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 24570381 |
| Molecular Formula | C15H13N3O2S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | N-[4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-yl]-1-oxidopyridin-1-ium-3-carboxamide |
| SMILES | Cc1cc(-c2csc(NC(=O)c3ccc[n+]([O-])c3)n2)c(C)s1 |
| InChI | InChI=1S/C15H13N3O2S2/c1-9-6-12(10(2)22-9)13-8-21-15(16-13)17-14(19)11-4-3-5-18(20)7-11/h3-8H,1-2H3,(H,16,17,19) |
| InChIKey | UIUMLKYCOFSMBU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 68.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|