C19H18N6OS3 — CID 24581099
1-propan-2-yl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 24581099) has the molecular formula C19H18N6OS3 and a molecular weight of 442.60 g/mol. Its IUPAC name is 1-propan-2-yl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 1-propan-2-yl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 24581099 |
| Molecular Formula | C19H18N6OS3 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | 1-propan-2-yl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | C=CCSc1nnc(NC(=O)c2cc(-c3cccs3)nc3c2cnn3C(C)C)s1 |
| InChI | InChI=1S/C19H18N6OS3/c1-4-7-28-19-24-23-18(29-19)22-17(26)12-9-14(15-6-5-8-27-15)21-16-13(12)10-20-25(16)11(2)3/h4-6,8-11H,1,7H2,2-3H3,(H,22,23,26) |
| InChIKey | SVZJRAFPROADGG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|