C23H20N6O2S2 — CID 24581186
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-6-(furan-2-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 24581186) has the molecular formula C23H20N6O2S2 and a molecular weight of 476.59 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-6-(furan-2-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-6-(furan-2-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 24581186 |
| Molecular Formula | C23H20N6O2S2 |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-6-(furan-2-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | CC(C)n1ncc2c(C(=O)Nc3nnc(SCc4ccccc4)s3)cc(-c3ccco3)nc21 |
| InChI | InChI=1S/C23H20N6O2S2/c1-14(2)29-20-17(12-24-29)16(11-18(25-20)19-9-6-10-31-19)21(30)26-22-27-28-23(33-22)32-13-15-7-4-3-5-8-15/h3-12,14H,13H2,1-2H3,(H,26,27,30) |
| InChIKey | NNUHBDXKTPQOGF-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 98.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|