C18H18N6O2S2 — CID 24580729
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-6-(furan-2-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 24580729) has the molecular formula C18H18N6O2S2 and a molecular weight of 414.52 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-6-(furan-2-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-6-(furan-2-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 24580729 |
| Molecular Formula | C18H18N6O2S2 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-6-(furan-2-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | CCSc1nnc(NC(=O)c2cc(-c3ccco3)nc3c2cnn3C(C)C)s1 |
| InChI | InChI=1S/C18H18N6O2S2/c1-4-27-18-23-22-17(28-18)21-16(25)11-8-13(14-6-5-7-26-14)20-15-12(11)9-19-24(15)10(2)3/h5-10H,4H2,1-3H3,(H,21,22,25) |
| InChIKey | SYZWNBQZNCJKLM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 98.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|