C17H20N6OS2 — CID 7589390
6-cyclopropyl-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 7589390) has the molecular formula C17H20N6OS2 and a molecular weight of 388.52 g/mol. Its IUPAC name is 6-cyclopropyl-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 6-cyclopropyl-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 7589390 |
| Molecular Formula | C17H20N6OS2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 6-cyclopropyl-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | CCSc1nnc(NC(=O)c2cc(C3CC3)nc3c2cnn3C(C)C)s1 |
| InChI | InChI=1S/C17H20N6OS2/c1-4-25-17-22-21-16(26-17)20-15(24)11-7-13(10-5-6-10)19-14-12(11)8-18-23(14)9(2)3/h7-10H,4-6H2,1-3H3,(H,20,21,24) |
| InChIKey | LPZGHEFOSHYYLC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|