C14H16N6OS2 — CID 29407607
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 29407607) has the molecular formula C14H16N6OS2 and a molecular weight of 348.46 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 29407607 |
| Molecular Formula | C14H16N6OS2 |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | CCSc1nnc(NC(=O)c2cnc3c(cnn3C(C)C)c2)s1 |
| InChI | InChI=1S/C14H16N6OS2/c1-4-22-14-19-18-13(23-14)17-12(21)10-5-9-7-16-20(8(2)3)11(9)15-6-10/h5-8H,4H2,1-3H3,(H,17,18,21) |
| InChIKey | LKLYGLHTYMYGLT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|