C15H10Cl2N6O4 — CID 24582205
N-(4-chloro-3-nitrophenyl)-2-[4-(2-chlorophenyl)-5-oxotetrazol-1-yl]acetamide (PubChem CID 24582205) has the molecular formula C15H10Cl2N6O4 and a molecular weight of 409.19 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)-2-[4-(2-chlorophenyl)-5-oxotetrazol-1-yl]acetamide.
| Compound Name | N-(4-chloro-3-nitrophenyl)-2-[4-(2-chlorophenyl)-5-oxotetrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 24582205 |
| Molecular Formula | C15H10Cl2N6O4 |
| Molecular Weight | 409.19 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)-2-[4-(2-chlorophenyl)-5-oxotetrazol-1-yl]acetamide |
| SMILES | O=C(Cn1nnn(-c2ccccc2Cl)c1=O)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H10Cl2N6O4/c16-10-3-1-2-4-12(10)22-15(25)21(19-20-22)8-14(24)18-9-5-6-11(17)13(7-9)23(26)27/h1-7H,8H2,(H,18,24) |
| InChIKey | VEFDXPNLYPLAIO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 124.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|