C17H13Cl2N5O3 — CID 100761249
N-(4-chloro-3-nitrophenyl)-2-[4-(4-chlorophenyl)-5-methyltriazol-1-yl]acetamide (PubChem CID 100761249) has the molecular formula C17H13Cl2N5O3 and a molecular weight of 406.23 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)-2-[4-(4-chlorophenyl)-5-methyltriazol-1-yl]acetamide.
| Compound Name | N-(4-chloro-3-nitrophenyl)-2-[4-(4-chlorophenyl)-5-methyltriazol-1-yl]acetamide |
|---|---|
| PubChem CID | 100761249 |
| Molecular Formula | C17H13Cl2N5O3 |
| Molecular Weight | 406.23 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)-2-[4-(4-chlorophenyl)-5-methyltriazol-1-yl]acetamide |
| SMILES | Cc1c(-c2ccc(Cl)cc2)nnn1CC(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H13Cl2N5O3/c1-10-17(11-2-4-12(18)5-3-11)21-22-23(10)9-16(25)20-13-6-7-14(19)15(8-13)24(26)27/h2-8H,9H2,1H3,(H,20,25) |
| InChIKey | UZAHOCRFJPJVTB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.23 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|