C24H30N2O3S2 — CID 24583286
N-cyclohexyl-N-(1,1-dioxothiolan-3-yl)-2-(2-phenylsulfanylanilino)acetamide (PubChem CID 24583286) has the molecular formula C24H30N2O3S2 and a molecular weight of 458.65 g/mol. Its IUPAC name is N-cyclohexyl-N-(1,1-dioxothiolan-3-yl)-2-(2-phenylsulfanylanilino)acetamide.
| Compound Name | N-cyclohexyl-N-(1,1-dioxothiolan-3-yl)-2-(2-phenylsulfanylanilino)acetamide |
|---|---|
| PubChem CID | 24583286 |
| Molecular Formula | C24H30N2O3S2 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | N-cyclohexyl-N-(1,1-dioxothiolan-3-yl)-2-(2-phenylsulfanylanilino)acetamide |
| SMILES | O=C(CNc1ccccc1Sc1ccccc1)N(C1CCCCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C24H30N2O3S2/c27-24(26(19-9-3-1-4-10-19)20-15-16-31(28,29)18-20)17-25-22-13-7-8-14-23(22)30-21-11-5-2-6-12-21/h2,5-8,11-14,19-20,25H,1,3-4,9-10,15-18H2 |
| InChIKey | IXAKZBPLNPPLPL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |