C20H25N3O5S — CID 24583306
ethyl 2-[[2-(5-acetamido-2-methoxyanilino)acetyl]amino]-5-ethylthiophene-3-carboxylate (PubChem CID 24583306) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is ethyl 2-[[2-(5-acetamido-2-methoxyanilino)acetyl]amino]-5-ethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(5-acetamido-2-methoxyanilino)acetyl]amino]-5-ethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 24583306 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | ethyl 2-[[2-(5-acetamido-2-methoxyanilino)acetyl]amino]-5-ethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CC)sc1NC(=O)CNc1cc(NC(C)=O)ccc1OC |
| InChI | InChI=1S/C20H25N3O5S/c1-5-14-10-15(20(26)28-6-2)19(29-14)23-18(25)11-21-16-9-13(22-12(3)24)7-8-17(16)27-4/h7-10,21H,5-6,11H2,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | HTKPWKAWFAQFDG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |