C17H15F3IN3O2 — CID 24583375
2-[[2-(2-iodoanilino)-2-oxoethyl]amino]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 24583375) has the molecular formula C17H15F3IN3O2 and a molecular weight of 477.22 g/mol. Its IUPAC name is 2-[[2-(2-iodoanilino)-2-oxoethyl]amino]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-[[2-(2-iodoanilino)-2-oxoethyl]amino]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 24583375 |
| Molecular Formula | C17H15F3IN3O2 |
| Molecular Weight | 477.22 g/mol |
| Exact Mass | 477.02 |
| IUPAC Name | 2-[[2-(2-iodoanilino)-2-oxoethyl]amino]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(CNc1ccccc1C(=O)NCC(F)(F)F)Nc1ccccc1I |
| InChI | InChI=1S/C17H15F3IN3O2/c18-17(19,20)10-23-16(26)11-5-1-3-7-13(11)22-9-15(25)24-14-8-4-2-6-12(14)21/h1-8,22H,9-10H2,(H,23,26)(H,24,25) |
| InChIKey | ASUHGRNUBWTYNT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.22 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|