C25H27N3O4S — CID 24583578
2,2-dimethyl-N-[4-methyl-5-[[[2-(2-phenylphenoxy)acetyl]amino]carbamoyl]thiophen-2-yl]propanamide (PubChem CID 24583578) has the molecular formula C25H27N3O4S and a molecular weight of 465.58 g/mol. Its IUPAC name is 2,2-dimethyl-N-[4-methyl-5-[[[2-(2-phenylphenoxy)acetyl]amino]carbamoyl]thiophen-2-yl]propanamide.
| Compound Name | 2,2-dimethyl-N-[4-methyl-5-[[[2-(2-phenylphenoxy)acetyl]amino]carbamoyl]thiophen-2-yl]propanamide |
|---|---|
| PubChem CID | 24583578 |
| Molecular Formula | C25H27N3O4S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 2,2-dimethyl-N-[4-methyl-5-[[[2-(2-phenylphenoxy)acetyl]amino]carbamoyl]thiophen-2-yl]propanamide |
| SMILES | Cc1cc(NC(=O)C(C)(C)C)sc1C(=O)NNC(=O)COc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C25H27N3O4S/c1-16-14-21(26-24(31)25(2,3)4)33-22(16)23(30)28-27-20(29)15-32-19-13-9-8-12-18(19)17-10-6-5-7-11-17/h5-14H,15H2,1-4H3,(H,26,31)(H,27,29)(H,28,30) |
| InChIKey | VTLTXMUPDHNILU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|