C23H27N3O2 — CID 24584534
1-(1,3-benzoxazol-2-yl)-N-butyl-N-phenylpiperidine-4-carboxamide (PubChem CID 24584534) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)-N-butyl-N-phenylpiperidine-4-carboxamide.
| Compound Name | 1-(1,3-benzoxazol-2-yl)-N-butyl-N-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 24584534 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)-N-butyl-N-phenylpiperidine-4-carboxamide |
| SMILES | CCCCN(C(=O)C1CCN(c2nc3ccccc3o2)CC1)c1ccccc1 |
| InChI | InChI=1S/C23H27N3O2/c1-2-3-15-26(19-9-5-4-6-10-19)22(27)18-13-16-25(17-14-18)23-24-20-11-7-8-12-21(20)28-23/h4-12,18H,2-3,13-17H2,1H3 |
| InChIKey | OZXSFKNXNIRIJJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |