C22H25N5O2S2 — CID 24584849
2-[(1-benzylimidazol-2-yl)sulfanylmethyl]-1-butylbenzimidazole-5-sulfonamide (PubChem CID 24584849) has the molecular formula C22H25N5O2S2 and a molecular weight of 455.61 g/mol. Its IUPAC name is 2-[(1-benzylimidazol-2-yl)sulfanylmethyl]-1-butylbenzimidazole-5-sulfonamide.
| Compound Name | 2-[(1-benzylimidazol-2-yl)sulfanylmethyl]-1-butylbenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 24584849 |
| Molecular Formula | C22H25N5O2S2 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 2-[(1-benzylimidazol-2-yl)sulfanylmethyl]-1-butylbenzimidazole-5-sulfonamide |
| SMILES | CCCCn1c(CSc2nccn2Cc2ccccc2)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C22H25N5O2S2/c1-2-3-12-27-20-10-9-18(31(23,28)29)14-19(20)25-21(27)16-30-22-24-11-13-26(22)15-17-7-5-4-6-8-17/h4-11,13-14H,2-3,12,15-16H2,1H3,(H2,23,28,29) |
| InChIKey | FCQQTBHBJVFGRM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 95.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |