C16H12BrClF3NO2 — CID 24586847
N-(4-bromo-2-chlorophenyl)-4-(2,2,2-trifluoroethoxymethyl)benzamide (PubChem CID 24586847) has the molecular formula C16H12BrClF3NO2 and a molecular weight of 422.63 g/mol. Its IUPAC name is N-(4-bromo-2-chlorophenyl)-4-(2,2,2-trifluoroethoxymethyl)benzamide.
| Compound Name | N-(4-bromo-2-chlorophenyl)-4-(2,2,2-trifluoroethoxymethyl)benzamide |
|---|---|
| PubChem CID | 24586847 |
| Molecular Formula | C16H12BrClF3NO2 |
| Molecular Weight | 422.63 g/mol |
| Exact Mass | 420.97 |
| IUPAC Name | N-(4-bromo-2-chlorophenyl)-4-(2,2,2-trifluoroethoxymethyl)benzamide |
| SMILES | O=C(Nc1ccc(Br)cc1Cl)c1ccc(COCC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H12BrClF3NO2/c17-12-5-6-14(13(18)7-12)22-15(23)11-3-1-10(2-4-11)8-24-9-16(19,20)21/h1-7H,8-9H2,(H,22,23) |
| InChIKey | MACDLVAUWVJESH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.63 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |