C22H19N5O3 — CID 24586964
N'-[2-(2-cyanophenoxy)acetyl]-1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbohydrazide (PubChem CID 24586964) has the molecular formula C22H19N5O3 and a molecular weight of 401.43 g/mol. Its IUPAC name is N'-[2-(2-cyanophenoxy)acetyl]-1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbohydrazide.
| Compound Name | N'-[2-(2-cyanophenoxy)acetyl]-1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 24586964 |
| Molecular Formula | C22H19N5O3 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | N'-[2-(2-cyanophenoxy)acetyl]-1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbohydrazide |
| SMILES | N#Cc1ccccc1OCC(=O)NNC(=O)c1nn(-c2ccccc2)c2c1CCC2 |
| InChI | InChI=1S/C22H19N5O3/c23-13-15-7-4-5-12-19(15)30-14-20(28)24-25-22(29)21-17-10-6-11-18(17)27(26-21)16-8-2-1-3-9-16/h1-5,7-9,12H,6,10-11,14H2,(H,24,28)(H,25,29) |
| InChIKey | LJNCZYJFBVBROL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 109.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|