C19H22N4O3S2 — CID 24589582
N-(2-cyanophenyl)-3-[[5-(diethylsulfamoyl)-2-pyridinyl]sulfanyl]propanamide (PubChem CID 24589582) has the molecular formula C19H22N4O3S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is N-(2-cyanophenyl)-3-[[5-(diethylsulfamoyl)-2-pyridinyl]sulfanyl]propanamide.
| Compound Name | N-(2-cyanophenyl)-3-[[5-(diethylsulfamoyl)-2-pyridinyl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 24589582 |
| Molecular Formula | C19H22N4O3S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | N-(2-cyanophenyl)-3-[[5-(diethylsulfamoyl)-2-pyridinyl]sulfanyl]propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(SCCC(=O)Nc2ccccc2C#N)nc1 |
| InChI | InChI=1S/C19H22N4O3S2/c1-3-23(4-2)28(25,26)16-9-10-19(21-14-16)27-12-11-18(24)22-17-8-6-5-7-15(17)13-20/h5-10,14H,3-4,11-12H2,1-2H3,(H,22,24) |
| InChIKey | BQOAJTLIJYVFES-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |