C18H22N4O5S2 — CID 30028187
2-[[5-(diethylsulfamoyl)-2-pyridinyl]sulfanyl]-N-(2-methyl-5-nitrophenyl)acetamide (PubChem CID 30028187) has the molecular formula C18H22N4O5S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 2-[[5-(diethylsulfamoyl)-2-pyridinyl]sulfanyl]-N-(2-methyl-5-nitrophenyl)acetamide.
| Compound Name | 2-[[5-(diethylsulfamoyl)-2-pyridinyl]sulfanyl]-N-(2-methyl-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 30028187 |
| Molecular Formula | C18H22N4O5S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 2-[[5-(diethylsulfamoyl)-2-pyridinyl]sulfanyl]-N-(2-methyl-5-nitrophenyl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(SCC(=O)Nc2cc([N+](=O)[O-])ccc2C)nc1 |
| InChI | InChI=1S/C18H22N4O5S2/c1-4-21(5-2)29(26,27)15-8-9-18(19-11-15)28-12-17(23)20-16-10-14(22(24)25)7-6-13(16)3/h6-11H,4-5,12H2,1-3H3,(H,20,23) |
| InChIKey | AVPDQCJNHGYSLV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|