C19H22N4O6S2 — CID 30117298
N-(2-methoxy-4-nitrophenyl)-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]acetamide (PubChem CID 30117298) has the molecular formula C19H22N4O6S2 and a molecular weight of 466.54 g/mol. Its IUPAC name is N-(2-methoxy-4-nitrophenyl)-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]acetamide.
| Compound Name | N-(2-methoxy-4-nitrophenyl)-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 30117298 |
| Molecular Formula | C19H22N4O6S2 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | N-(2-methoxy-4-nitrophenyl)-2-[(5-piperidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]acetamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)CSc1ccc(S(=O)(=O)N2CCCCC2)cn1 |
| InChI | InChI=1S/C19H22N4O6S2/c1-29-17-11-14(23(25)26)5-7-16(17)21-18(24)13-30-19-8-6-15(12-20-19)31(27,28)22-9-3-2-4-10-22/h5-8,11-12H,2-4,9-10,13H2,1H3,(H,21,24) |
| InChIKey | FKRLPSAMOVIGDS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|