C17H23N5O2S2 — CID 24592985
N-(benzylcarbamoyl)-3-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide (PubChem CID 24592985) has the molecular formula C17H23N5O2S2 and a molecular weight of 393.54 g/mol. Its IUPAC name is N-(benzylcarbamoyl)-3-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | N-(benzylcarbamoyl)-3-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 24592985 |
| Molecular Formula | C17H23N5O2S2 |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | N-(benzylcarbamoyl)-3-[[5-(butylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
| SMILES | CCCCNc1nnc(SCCC(=O)NC(=O)NCc2ccccc2)s1 |
| InChI | InChI=1S/C17H23N5O2S2/c1-2-3-10-18-16-21-22-17(26-16)25-11-9-14(23)20-15(24)19-12-13-7-5-4-6-8-13/h4-8H,2-3,9-12H2,1H3,(H,18,21)(H2,19,20,23,24) |
| InChIKey | XGVULJRNKXFIRS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|