C22H22ClN5O3S — CID 24593939
N-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-[4-(2-nitrophenyl)piperazin-1-yl]acetamide (PubChem CID 24593939) has the molecular formula C22H22ClN5O3S and a molecular weight of 471.97 g/mol. Its IUPAC name is N-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-[4-(2-nitrophenyl)piperazin-1-yl]acetamide.
| Compound Name | N-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-[4-(2-nitrophenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 24593939 |
| Molecular Formula | C22H22ClN5O3S |
| Molecular Weight | 471.97 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | N-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-[4-(2-nitrophenyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(c2ccccc2[N+](=O)[O-])CC1)Nc1ncc(Cc2ccccc2Cl)s1 |
| InChI | InChI=1S/C22H22ClN5O3S/c23-18-6-2-1-5-16(18)13-17-14-24-22(32-17)25-21(29)15-26-9-11-27(12-10-26)19-7-3-4-8-20(19)28(30)31/h1-8,14H,9-13,15H2,(H,24,25,29) |
| InChIKey | ZMTQQTBNHLZPBP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.97 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|