C21H17BrN4O3S — CID 24598685
N-[5-[(4-bromophenyl)methyl]-1,3-thiazol-2-yl]-2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide (PubChem CID 24598685) has the molecular formula C21H17BrN4O3S and a molecular weight of 485.36 g/mol. Its IUPAC name is N-[5-[(4-bromophenyl)methyl]-1,3-thiazol-2-yl]-2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide.
| Compound Name | N-[5-[(4-bromophenyl)methyl]-1,3-thiazol-2-yl]-2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 24598685 |
| Molecular Formula | C21H17BrN4O3S |
| Molecular Weight | 485.36 g/mol |
| Exact Mass | 484.02 |
| IUPAC Name | N-[5-[(4-bromophenyl)methyl]-1,3-thiazol-2-yl]-2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide |
| SMILES | O=C(Nc1ncc(Cc2ccc(Br)cc2)s1)c1ccccc1CN1C(=O)CNC1=O |
| InChI | InChI=1S/C21H17BrN4O3S/c22-15-7-5-13(6-8-15)9-16-10-23-20(30-16)25-19(28)17-4-2-1-3-14(17)12-26-18(27)11-24-21(26)29/h1-8,10H,9,11-12H2,(H,24,29)(H,23,25,28) |
| InChIKey | KIPQUZCQRSXSKZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|