C21H19F2N3O — CID 24599608
2-cyclopent-2-en-1-yl-N-[4-[1-(difluoromethyl)benzimidazol-2-yl]phenyl]acetamide (PubChem CID 24599608) has the molecular formula C21H19F2N3O and a molecular weight of 367.40 g/mol. Its IUPAC name is 2-cyclopent-2-en-1-yl-N-[4-[1-(difluoromethyl)benzimidazol-2-yl]phenyl]acetamide.
| Compound Name | 2-cyclopent-2-en-1-yl-N-[4-[1-(difluoromethyl)benzimidazol-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 24599608 |
| Molecular Formula | C21H19F2N3O |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-cyclopent-2-en-1-yl-N-[4-[1-(difluoromethyl)benzimidazol-2-yl]phenyl]acetamide |
| SMILES | O=C(CC1C=CCC1)Nc1ccc(-c2nc3ccccc3n2C(F)F)cc1 |
| InChI | InChI=1S/C21H19F2N3O/c22-21(23)26-18-8-4-3-7-17(18)25-20(26)15-9-11-16(12-10-15)24-19(27)13-14-5-1-2-6-14/h1,3-5,7-12,14,21H,2,6,13H2,(H,24,27) |
| InChIKey | UJMVRAGWZLPNJV-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|