C24H20F3N3O2 — CID 24599846
N-[2-(1H-indol-3-yl)-2-phenylethyl]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide (PubChem CID 24599846) has the molecular formula C24H20F3N3O2 and a molecular weight of 439.44 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)-2-phenylethyl]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide.
| Compound Name | N-[2-(1H-indol-3-yl)-2-phenylethyl]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 24599846 |
| Molecular Formula | C24H20F3N3O2 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | N-[2-(1H-indol-3-yl)-2-phenylethyl]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
| SMILES | O=C(Cn1cc(C(F)(F)F)ccc1=O)NCC(c1ccccc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H20F3N3O2/c25-24(26,27)17-10-11-23(32)30(14-17)15-22(31)29-12-19(16-6-2-1-3-7-16)20-13-28-21-9-5-4-8-18(20)21/h1-11,13-14,19,28H,12,15H2,(H,29,31) |
| InChIKey | KVCORLGIVMHPQJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |