C20H18N2O5S2 — CID 24602714
4-methoxy-3-[[4-(pyridin-3-ylmethylsulfanyl)phenyl]sulfamoyl]benzoic acid (PubChem CID 24602714) has the molecular formula C20H18N2O5S2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 4-methoxy-3-[[4-(pyridin-3-ylmethylsulfanyl)phenyl]sulfamoyl]benzoic acid.
| Compound Name | 4-methoxy-3-[[4-(pyridin-3-ylmethylsulfanyl)phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 24602714 |
| Molecular Formula | C20H18N2O5S2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 4-methoxy-3-[[4-(pyridin-3-ylmethylsulfanyl)phenyl]sulfamoyl]benzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1S(=O)(=O)Nc1ccc(SCc2cccnc2)cc1 |
| InChI | InChI=1S/C20H18N2O5S2/c1-27-18-9-4-15(20(23)24)11-19(18)29(25,26)22-16-5-7-17(8-6-16)28-13-14-3-2-10-21-12-14/h2-12,22H,13H2,1H3,(H,23,24) |
| InChIKey | ZPMQWZMCZFUHPD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |