C19H24N4O4S — CID 24614024
2-(benzylcarbamoylamino)-N-[[2-(dimethylsulfamoyl)phenyl]methyl]acetamide (PubChem CID 24614024) has the molecular formula C19H24N4O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is 2-(benzylcarbamoylamino)-N-[[2-(dimethylsulfamoyl)phenyl]methyl]acetamide.
| Compound Name | 2-(benzylcarbamoylamino)-N-[[2-(dimethylsulfamoyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 24614024 |
| Molecular Formula | C19H24N4O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 2-(benzylcarbamoylamino)-N-[[2-(dimethylsulfamoyl)phenyl]methyl]acetamide |
| SMILES | CN(C)S(=O)(=O)c1ccccc1CNC(=O)CNC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H24N4O4S/c1-23(2)28(26,27)17-11-7-6-10-16(17)13-20-18(24)14-22-19(25)21-12-15-8-4-3-5-9-15/h3-11H,12-14H2,1-2H3,(H,20,24)(H2,21,22,25) |
| InChIKey | UXXDGFGOUAVXPK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |