C19H26N4O3S — CID 41430913
1-[[4-(dimethylamino)phenyl]methyl]-3-[[2-(dimethylsulfamoyl)phenyl]methyl]urea (PubChem CID 41430913) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]methyl]-3-[[2-(dimethylsulfamoyl)phenyl]methyl]urea.
| Compound Name | 1-[[4-(dimethylamino)phenyl]methyl]-3-[[2-(dimethylsulfamoyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 41430913 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]methyl]-3-[[2-(dimethylsulfamoyl)phenyl]methyl]urea |
| SMILES | CN(C)c1ccc(CNC(=O)NCc2ccccc2S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C19H26N4O3S/c1-22(2)17-11-9-15(10-12-17)13-20-19(24)21-14-16-7-5-6-8-18(16)27(25,26)23(3)4/h5-12H,13-14H2,1-4H3,(H2,20,21,24) |
| InChIKey | QEMZBPNZDJXRAQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|