C13H17N3O3S — CID 17459150
1-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-prop-2-ynylurea (PubChem CID 17459150) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-prop-2-ynylurea.
| Compound Name | 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-prop-2-ynylurea |
|---|---|
| PubChem CID | 17459150 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-prop-2-ynylurea |
| SMILES | C#CCNC(=O)NCc1ccccc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C13H17N3O3S/c1-4-9-14-13(17)15-10-11-7-5-6-8-12(11)20(18,19)16(2)3/h1,5-8H,9-10H2,2-3H3,(H2,14,15,17) |
| InChIKey | SIQRKBIFSDYOIB-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|