C18H22FN3O3S — CID 30271369
1-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-[(1S)-1-(2-fluorophenyl)ethyl]urea (PubChem CID 30271369) has the molecular formula C18H22FN3O3S and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-[(1S)-1-(2-fluorophenyl)ethyl]urea.
| Compound Name | 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-[(1S)-1-(2-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 30271369 |
| Molecular Formula | C18H22FN3O3S |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-[(1S)-1-(2-fluorophenyl)ethyl]urea |
| SMILES | C[C@H](NC(=O)NCc1ccccc1S(=O)(=O)N(C)C)c1ccccc1F |
| InChI | InChI=1S/C18H22FN3O3S/c1-13(15-9-5-6-10-16(15)19)21-18(23)20-12-14-8-4-7-11-17(14)26(24,25)22(2)3/h4-11,13H,12H2,1-3H3,(H2,20,21,23)/t13-/m0/s1 |
| InChIKey | ARVCQINCZZYXCF-ZDUSSCGKSA-N |
| XLogP | 2.64 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |