C19H26N4O4S — CID 55744571
1-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-[(6-propan-2-yloxy-3-pyridinyl)methyl]urea (PubChem CID 55744571) has the molecular formula C19H26N4O4S and a molecular weight of 406.51 g/mol. Its IUPAC name is 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-[(6-propan-2-yloxy-3-pyridinyl)methyl]urea.
| Compound Name | 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-[(6-propan-2-yloxy-3-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 55744571 |
| Molecular Formula | C19H26N4O4S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-[(6-propan-2-yloxy-3-pyridinyl)methyl]urea |
| SMILES | CC(C)Oc1ccc(CNC(=O)NCc2ccccc2S(=O)(=O)N(C)C)cn1 |
| InChI | InChI=1S/C19H26N4O4S/c1-14(2)27-18-10-9-15(11-20-18)12-21-19(24)22-13-16-7-5-6-8-17(16)28(25,26)23(3)4/h5-11,14H,12-13H2,1-4H3,(H2,21,22,24) |
| InChIKey | BYOJXEVPVPIDFH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |