C19H22N4O4S — CID 55747187
2-[(4-cyanophenyl)sulfonyl-methylamino]-N-[(6-propan-2-yloxy-3-pyridinyl)methyl]acetamide (PubChem CID 55747187) has the molecular formula C19H22N4O4S and a molecular weight of 402.48 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)sulfonyl-methylamino]-N-[(6-propan-2-yloxy-3-pyridinyl)methyl]acetamide.
| Compound Name | 2-[(4-cyanophenyl)sulfonyl-methylamino]-N-[(6-propan-2-yloxy-3-pyridinyl)methyl]acetamide |
|---|---|
| PubChem CID | 55747187 |
| Molecular Formula | C19H22N4O4S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2-[(4-cyanophenyl)sulfonyl-methylamino]-N-[(6-propan-2-yloxy-3-pyridinyl)methyl]acetamide |
| SMILES | CC(C)Oc1ccc(CNC(=O)CN(C)S(=O)(=O)c2ccc(C#N)cc2)cn1 |
| InChI | InChI=1S/C19H22N4O4S/c1-14(2)27-19-9-6-16(12-22-19)11-21-18(24)13-23(3)28(25,26)17-7-4-15(10-20)5-8-17/h4-9,12,14H,11,13H2,1-3H3,(H,21,24) |
| InChIKey | QRVNLNFPXHHHLV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |