C18H17F2N3O4S — CID 49336755
2-[(4-cyanophenyl)sulfonyl-methylamino]-N-[[3-(difluoromethoxy)phenyl]methyl]acetamide (PubChem CID 49336755) has the molecular formula C18H17F2N3O4S and a molecular weight of 409.41 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)sulfonyl-methylamino]-N-[[3-(difluoromethoxy)phenyl]methyl]acetamide.
| Compound Name | 2-[(4-cyanophenyl)sulfonyl-methylamino]-N-[[3-(difluoromethoxy)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 49336755 |
| Molecular Formula | C18H17F2N3O4S |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 2-[(4-cyanophenyl)sulfonyl-methylamino]-N-[[3-(difluoromethoxy)phenyl]methyl]acetamide |
| SMILES | CN(CC(=O)NCc1cccc(OC(F)F)c1)S(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H17F2N3O4S/c1-23(28(25,26)16-7-5-13(10-21)6-8-16)12-17(24)22-11-14-3-2-4-15(9-14)27-18(19)20/h2-9,18H,11-12H2,1H3,(H,22,24) |
| InChIKey | FBIHRQKHJZISHJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |