C21H30N2O4 — CID 24625086
N'-[2-(4-ethoxyphenoxy)propanoyl]-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbohydrazide (PubChem CID 24625086) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is N'-[2-(4-ethoxyphenoxy)propanoyl]-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbohydrazide.
| Compound Name | N'-[2-(4-ethoxyphenoxy)propanoyl]-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbohydrazide |
|---|---|
| PubChem CID | 24625086 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | N'-[2-(4-ethoxyphenoxy)propanoyl]-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbohydrazide |
| SMILES | CCOc1ccc(OC(C)C(=O)NNC(=O)C2C(C=C(C)C)C2(C)C)cc1 |
| InChI | InChI=1S/C21H30N2O4/c1-7-26-15-8-10-16(11-9-15)27-14(4)19(24)22-23-20(25)18-17(12-13(2)3)21(18,5)6/h8-12,14,17-18H,7H2,1-6H3,(H,22,24)(H,23,25) |
| InChIKey | IHIFJQWYEHCGRA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|