C18H17N5S — CID 24626554
2-[(5-cyclopropyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]indolizine-1-carbonitrile (PubChem CID 24626554) has the molecular formula C18H17N5S and a molecular weight of 335.44 g/mol. Its IUPAC name is 2-[(5-cyclopropyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]indolizine-1-carbonitrile.
| Compound Name | 2-[(5-cyclopropyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]indolizine-1-carbonitrile |
|---|---|
| PubChem CID | 24626554 |
| Molecular Formula | C18H17N5S |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-[(5-cyclopropyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]indolizine-1-carbonitrile |
| SMILES | C=CCn1c(SCc2cn3ccccc3c2C#N)nnc1C1CC1 |
| InChI | InChI=1S/C18H17N5S/c1-2-8-23-17(13-6-7-13)20-21-18(23)24-12-14-11-22-9-4-3-5-16(22)15(14)10-19/h2-5,9,11,13H,1,6-8,12H2 |
| InChIKey | SHDLDRRZUPJKTD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 58.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|