C19H22F3N3S — CID 7215074
3-cyclohexyl-4-prop-2-enyl-5-[[2-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazole (PubChem CID 7215074) has the molecular formula C19H22F3N3S and a molecular weight of 381.47 g/mol. Its IUPAC name is 3-cyclohexyl-4-prop-2-enyl-5-[[2-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazole.
| Compound Name | 3-cyclohexyl-4-prop-2-enyl-5-[[2-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 7215074 |
| Molecular Formula | C19H22F3N3S |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 3-cyclohexyl-4-prop-2-enyl-5-[[2-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazole |
| SMILES | C=CCn1c(SCc2ccccc2C(F)(F)F)nnc1C1CCCCC1 |
| InChI | InChI=1S/C19H22F3N3S/c1-2-12-25-17(14-8-4-3-5-9-14)23-24-18(25)26-13-15-10-6-7-11-16(15)19(20,21)22/h2,6-7,10-11,14H,1,3-5,8-9,12-13H2 |
| InChIKey | TUOQEUJDRKPRKP-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|