C22H19N5OS — CID 55482850
2-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]indolizine-1-carbonitrile (PubChem CID 55482850) has the molecular formula C22H19N5OS and a molecular weight of 401.50 g/mol. Its IUPAC name is 2-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]indolizine-1-carbonitrile.
| Compound Name | 2-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]indolizine-1-carbonitrile |
|---|---|
| PubChem CID | 55482850 |
| Molecular Formula | C22H19N5OS |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]indolizine-1-carbonitrile |
| SMILES | C=CCn1c(SCc2cn3ccccc3c2C#N)nnc1-c1ccccc1OC |
| InChI | InChI=1S/C22H19N5OS/c1-3-11-27-21(17-8-4-5-10-20(17)28-2)24-25-22(27)29-15-16-14-26-12-7-6-9-19(26)18(16)13-23/h3-10,12,14H,1,11,15H2,2H3 |
| InChIKey | RWKLFLLCFJATON-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 68.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|