C19H22N4O3S — CID 24627468
3-(2-nitroanilino)-N-prop-2-enyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propanamide (PubChem CID 24627468) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is 3-(2-nitroanilino)-N-prop-2-enyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | 3-(2-nitroanilino)-N-prop-2-enyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 24627468 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 3-(2-nitroanilino)-N-prop-2-enyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propanamide |
| SMILES | C=CCN(C(=O)CCNc1ccccc1[N+](=O)[O-])c1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C19H22N4O3S/c1-2-13-22(19-21-15-8-4-6-10-17(15)27-19)18(24)11-12-20-14-7-3-5-9-16(14)23(25)26/h2-3,5,7,9,20H,1,4,6,8,10-13H2 |
| InChIKey | ALIVPPLVCWYDEK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|