C20H19N3OS — CID 9112095
(E)-3-(4-cyanophenyl)-N-prop-2-enyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 9112095) has the molecular formula C20H19N3OS and a molecular weight of 349.46 g/mol. Its IUPAC name is (E)-3-(4-cyanophenyl)-N-prop-2-enyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(4-cyanophenyl)-N-prop-2-enyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9112095 |
| Molecular Formula | C20H19N3OS |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (E)-3-(4-cyanophenyl)-N-prop-2-enyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | C=CCN(C(=O)/C=C/c1ccc(C#N)cc1)c1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C20H19N3OS/c1-2-13-23(20-22-17-5-3-4-6-18(17)25-20)19(24)12-11-15-7-9-16(14-21)10-8-15/h2,7-12H,1,3-6,13H2/b12-11+ |
| InChIKey | GOUMZFOGNZRRCL-VAWYXSNFSA-N |
| XLogP | 4.13 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|