C22H24N4O6 — CID 24628005
1-[2-(morpholine-4-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]-3-(2-nitroanilino)propan-1-one (PubChem CID 24628005) has the molecular formula C22H24N4O6 and a molecular weight of 440.46 g/mol. Its IUPAC name is 1-[2-(morpholine-4-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]-3-(2-nitroanilino)propan-1-one.
| Compound Name | 1-[2-(morpholine-4-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]-3-(2-nitroanilino)propan-1-one |
|---|---|
| PubChem CID | 24628005 |
| Molecular Formula | C22H24N4O6 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 1-[2-(morpholine-4-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]-3-(2-nitroanilino)propan-1-one |
| SMILES | O=C(C1CN(C(=O)CCNc2ccccc2[N+](=O)[O-])c2ccccc2O1)N1CCOCC1 |
| InChI | InChI=1S/C22H24N4O6/c27-21(9-10-23-16-5-1-2-6-17(16)26(29)30)25-15-20(22(28)24-11-13-31-14-12-24)32-19-8-4-3-7-18(19)25/h1-8,20,23H,9-15H2 |
| InChIKey | PDNUESKOAGYYLR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|