C24H26N4O3 — CID 24634756
N'-[2-(1-methylbenzimidazol-2-yl)acetyl]-2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)acetohydrazide (PubChem CID 24634756) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is N'-[2-(1-methylbenzimidazol-2-yl)acetyl]-2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)acetohydrazide.
| Compound Name | N'-[2-(1-methylbenzimidazol-2-yl)acetyl]-2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)acetohydrazide |
|---|---|
| PubChem CID | 24634756 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N'-[2-(1-methylbenzimidazol-2-yl)acetyl]-2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)acetohydrazide |
| SMILES | Cc1cc2occ(CC(=O)NNC(=O)Cc3nc4ccccc4n3C)c2cc1C(C)C |
| InChI | InChI=1S/C24H26N4O3/c1-14(2)17-11-18-16(13-31-21(18)9-15(17)3)10-23(29)26-27-24(30)12-22-25-19-7-5-6-8-20(19)28(22)4/h5-9,11,13-14H,10,12H2,1-4H3,(H,26,29)(H,27,30) |
| InChIKey | GVFAFPCPHWOEKL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|